EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23F3N2O2 |
| Net Charge | 0 |
| Average Mass | 380.410 |
| Monoisotopic Mass | 380.17116 |
| SMILES | CC(C)c1ccc(CC(=O)N[C@H](C)c2ccc(OCC(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C20H23F3N2O2/c1-13(2)16-6-4-15(5-7-16)10-19(26)25-14(3)18-9-8-17(11-24-18)27-12-20(21,22)23/h4-9,11,13-14H,10,12H2,1-3H3,(H,25,26)/t14-/m1/s1 |
| InChIKey | IQIKXZMPPBEWAD-CQSZACIVSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suvecaltamide (CHEBI:749963) has role anticonvulsant (CHEBI:35623) |
| suvecaltamide (CHEBI:749963) has role antipsychotic agent (CHEBI:35476) |
| suvecaltamide (CHEBI:749963) is a monoterpenoid (CHEBI:25409) |
| INN | Source |
|---|---|
| suvecaltamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| CX-8998 | ChEMBL |
| JZP-385 | ChEMBL |
| JZP385 | ChEMBL |
| MK-8998 | ChEMBL |
| Citations |
|---|