EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17FN4O3 |
| Net Charge | 0 |
| Average Mass | 308.313 |
| Monoisotopic Mass | 308.12847 |
| SMILES | CN1CCN(c2ccc(N3C[C@H](CO)OC3=O)cc2F)C=N1 |
| InChI | InChI=1S/C14H17FN4O3/c1-17-4-5-18(9-16-17)13-3-2-10(6-12(13)15)19-7-11(8-20)22-14(19)21/h2-3,6,9,11,20H,4-5,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | QLUWQAFDTNAYPN-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delpazolid (CHEBI:749962) has role antitubercular agent (CHEBI:33231) |
| delpazolid (CHEBI:749962) is a substituted aniline (CHEBI:48975) |
| INN | Source |
|---|---|
| delpazolid | WHO MedNet |
| Synonyms | Source |
|---|---|
| Lcb01-0371 | ChEMBL |
| LCB-01-0371 | ChEMBL |
| LCB-010371 | ChEMBL |
| Citations |
|---|