EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22NO.C11H7O3 |
| Net Charge | 0 |
| Average Mass | 443.543 |
| Monoisotopic Mass | 443.20966 |
| SMILES | C[N+](C)(CCOc1ccccc1)Cc1ccccc1.O=C([O-])c1cc2ccccc2cc1O |
| InChI | InChI=1S/C17H22NO.C11H8O3/c1-18(2,15-16-9-5-3-6-10-16)13-14-19-17-11-7-4-8-12-17;12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h3-12H,13-15H2,1-2H3;1-6,12H,(H,13,14)/q+1;/p-1 |
| InChIKey | PMPQCPQAHTXCDK-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bephenium hydroxynaphthoate (CHEBI:749960) is a naphthoic acid (CHEBI:25483) |
| INNs | Source |
|---|---|
| hidroxinaftoato de befenio | WHO MedNet |
| hydroxynaphtoate de bephenium | WHO MedNet |
| Synonyms | Source |
|---|---|
| Alcopara | ChEMBL |
| Befen | ChEMBL |
| Befeniol | ChEMBL |
| Bephenamine hydroxynaphthoate | ChEMBL |
| Bephenii hydroxynaphthoas | ChEMBL |
| Bephenium 3-hydroxy-2-naphthoate | ChEMBL |
| Brand Name | Source |
|---|---|
| Alcopar | ChEMBL |
| Citations |
|---|