EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H33ClFNO4 |
| Net Charge | 0 |
| Average Mass | 514.037 |
| Monoisotopic Mass | 513.20821 |
| SMILES | Cc1cc(-c2ccccc2[C@@H](C)OC[C@H](O)CNC(C)(C)Cc2ccc(Cl)c(F)c2)ccc1C(=O)O |
| InChI | InChI=1S/C29H33ClFNO4/c1-18-13-21(10-11-23(18)28(34)35)25-8-6-5-7-24(25)19(2)36-17-22(33)16-32-29(3,4)15-20-9-12-26(30)27(31)14-20/h5-14,19,22,32-33H,15-17H2,1-4H3,(H,34,35)/t19-,22-/m1/s1 |
| InChIKey | UNFHDRVFEQPUEL-DENIHFKCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| encaleret (CHEBI:749959) is a amphetamines (CHEBI:35338) |
| INN | Source |
|---|---|
| encaleret | WHO MedNet |
| Synonym | Source |
|---|---|
| JTT-305 | ChEMBL |
| Citations |
|---|