EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16ClN5O2 |
| Net Charge | 0 |
| Average Mass | 393.834 |
| Monoisotopic Mass | 393.09925 |
| SMILES | Cc1c(N[C@@H](c2nnc(-c3ccc(C#N)cc3)o2)[C@H](C)O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C20H16ClN5O2/c1-11-16(8-7-15(10-23)17(11)21)24-18(12(2)27)20-26-25-19(28-20)14-5-3-13(9-22)4-6-14/h3-8,12,18,24,27H,1-2H3/t12-,18+/m0/s1 |
| InChIKey | XMBUPPIEVAFYHO-KPZWWZAWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rad-140 (CHEBI:749958) has role antineoplastic agent (CHEBI:35610) |
| rad-140 (CHEBI:749958) is a benzenes (CHEBI:22712) |
| rad-140 (CHEBI:749958) is a nitrile (CHEBI:18379) |
| INN | Source |
|---|---|
| vosilasarm | WHO MedNet |
| Synonyms | Source |
|---|---|
| Rad-140 | ChEMBL |
| RAD140 | ChEMBL |
| Testolone | ChEMBL |
| Citations |
|---|