EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C33H43N3O6 |
| Net Charge | 0 |
| Average Mass | 614.183 |
| Monoisotopic Mass | 613.29186 |
| SMILES | Cl.[H][C@]1([C@H](O)C2CCCCC2)NC(=O)C2(CCN(Cc3ccc(Oc4ccc(C(=O)O)cc4)cc3)CC2)N(CCCC)C1=O |
| InChI | InChI=1S/C33H43N3O6.ClH/c1-2-3-19-36-30(38)28(29(37)24-7-5-4-6-8-24)34-32(41)33(36)17-20-35(21-18-33)22-23-9-13-26(14-10-23)42-27-15-11-25(12-16-27)31(39)40;/h9-16,24,28-29,37H,2-8,17-22H2,1H3,(H,34,41)(H,39,40);1H/t28-,29-;/m1./s1 |
| InChIKey | QNNBMSGFNQRUEH-PQQSRXGVSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aplaviroc hydrochloride (CHEBI:749956) has role anti-HIV agent (CHEBI:64946) |
| aplaviroc hydrochloride (CHEBI:749956) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Aplaviroc hcl | ChEMBL |
| Aplaviroc hydrochloride | ChEMBL |
| GW-873140A | ChEMBL |
| GW873140A | ChEMBL |
| Citations |
|---|