EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34N5O8P |
| Net Charge | 0 |
| Average Mass | 527.515 |
| Monoisotopic Mass | 527.21450 |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(COC1(Cn2cnc3cnc(N)nc32)CC1)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H34N5O8P/c1-20(2,3)17(28)31-12-34-36(30,35-13-32-18(29)21(4,5)6)14-33-22(7-8-22)10-27-11-25-15-9-24-19(23)26-16(15)27/h9,11H,7-8,10,12-14H2,1-6H3,(H2,23,24,26) |
| InChIKey | JLKJXDOWBVVABZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lb80380 (CHEBI:749950) has role anti-HBV agent (CHEBI:64951) |
| lb80380 (CHEBI:749950) has role renoprotective agent (CHEBI:231911) |
| lb80380 (CHEBI:749950) is a purines (CHEBI:26401) |
| Synonyms | Source |
|---|---|
| An-380 | ChEMBL |
| Besifovir dipivoxil | ChEMBL |
| Lb80380 | ChEMBL |
| LB 80380 | ChEMBL |
| LB-80380 | ChEMBL |
| Pmcdg dipivoxil | ChEMBL |
| Citations |
|---|