EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O6 |
| Net Charge | 0 |
| Average Mass | 488.665 |
| Monoisotopic Mass | 488.31379 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](C5=CC(=O)OC5)CC[C@]34O)[C@@]1(C)CC[C@H](O[C@H]1CC[C@@H](O)[C@H](C)O1)C2 |
| InChI | InChI=1S/C29H44O6/c1-17-24(30)6-7-26(34-17)35-20-8-11-27(2)19(15-20)4-5-23-22(27)9-12-28(3)21(10-13-29(23,28)32)18-14-25(31)33-16-18/h14,17,19-24,26,30,32H,4-13,15-16H2,1-3H3/t17-,19+,20-,21+,22-,23+,24+,26-,27-,28+,29-/m0/s1 |
| InChIKey | LDZRENBZALBYIS-XZUAUHNRSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ramnodigin (CHEBI:749949) is a cardenolide glycoside (CHEBI:38092) |
| INNs | Source |
|---|---|
| ramnodigin | WHO MedNet |
| ramnodigina | WHO MedNet |
| ramnodigine | WHO MedNet |
| Citations |
|---|