EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749947 - amdinocillin pivoxil
| Formula | C21H33N3O5S |
| Net Charge | 0 |
| Average Mass | 439.578 |
| Monoisotopic Mass | 439.21409 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)OCOC(=O)C(C)(C)C)N1C(=O)[C@H]2/N=C/N1CCCCCC1 |
| InChI | InChI=1S/C21H33N3O5S/c1-20(2,3)19(27)29-13-28-18(26)15-21(4,5)30-17-14(16(25)24(15)17)22-12-23-10-8-6-7-9-11-23/h12,14-15,17H,6-11,13H2,1-5H3/b22-12+/t14-,15+,17-/m1/s1 |
| InChIKey | NPGNOVNWUSPMDP-UTEPHESZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amdinocillin pivoxil (CHEBI:749947) has role antibacterial agent (CHEBI:33282) |
| amdinocillin pivoxil (CHEBI:749947) has role antiinfective agent (CHEBI:35441) |
| amdinocillin pivoxil (CHEBI:749947) is a peptide (CHEBI:16670) |
| INN | Source |
|---|---|
| pivmecilinam | WHO MedNet |
| Synonyms | Source |
|---|---|
| Pivya | ChEMBL |
| RO 10-9071 | ChEMBL |
| RO-10-9071 | ChEMBL |
| Citations |
|---|