EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749946 - plazomicin
| Formula | C25H48N6O10 |
| Net Charge | 0 |
| Average Mass | 592.691 |
| Monoisotopic Mass | 592.34319 |
| SMILES | CN[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3OC(CNCCO)=CC[C@H]3N)[C@@H](N)C[C@H]2NC(=O)[C@@H](O)CCN)OC[C@]1(C)O |
| InChI | InChI=1S/C25H48N6O10/c1-25(37)11-38-24(18(35)21(25)29-2)41-20-15(31-22(36)16(33)5-6-26)9-14(28)19(17(20)34)40-23-13(27)4-3-12(39-23)10-30-7-8-32/h3,13-21,23-24,29-30,32-35,37H,4-11,26-28H2,1-2H3,(H,31,36)/t13-,14+,15-,16+,17+,18-,19-,20+,21-,23-,24-,25+/m1/s1 |
| InChIKey | IYDYFVUFSPQPPV-PEXOCOHZSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plazomicin (CHEBI:749946) has functional parent γ-amino acid (CHEBI:33707) |
| plazomicin (CHEBI:749946) has role antibacterial agent (CHEBI:33282) |
| plazomicin (CHEBI:749946) has role antiinfective agent (CHEBI:35441) |
| plazomicin (CHEBI:749946) is a organonitrogen compound (CHEBI:35352) |
| plazomicin (CHEBI:749946) is a organooxygen compound (CHEBI:36963) |
| INNs | Source |
|---|---|
| plazomicina | WHO MedNet |
| plazomicine | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACHN-490 | ChEMBL |
| Plazomicin | ChEMBL |
| Citations |
|---|