EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H27FN8O3 |
| Net Charge | 0 |
| Average Mass | 530.564 |
| Monoisotopic Mass | 530.21901 |
| SMILES | Cc1c(NC(=O)OC[C@@H]2COCCN2)cn2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c12 |
| InChI | InChI=1S/C27H27FN8O3/c1-17-23(34-27(37)39-15-22-14-38-8-7-29-22)13-36-25(17)26(30-16-32-36)33-21-5-6-24-19(10-21)11-31-35(24)12-18-3-2-4-20(28)9-18/h2-6,9-11,13,16,22,29H,7-8,12,14-15H2,1H3,(H,34,37)(H,30,32,33)/t22-/m0/s1 |
| InChIKey | LUJZZYWHBDHDQX-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ac-480 (CHEBI:749942) has role antineoplastic agent (CHEBI:35610) |
| ac-480 (CHEBI:749942) is a indazoles (CHEBI:38769) |
| Synonyms | Source |
|---|---|
| AC-480 | ChEMBL |
| AC480 | ChEMBL |
| Bms 599626 | ChEMBL |
| BMS-599626 | ChEMBL |
| Citations |
|---|