EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749938 - fexinidazole
| Formula | C12H13N3O3S |
| Net Charge | 0 |
| Average Mass | 279.321 |
| Monoisotopic Mass | 279.06776 |
| SMILES | CSc1ccc(OCc2ncc([N+](=O)[O-])n2C)cc1 |
| InChI | InChI=1S/C12H13N3O3S/c1-14-11(13-7-12(14)15(16)17)8-18-9-3-5-10(19-2)6-4-9/h3-7H,8H2,1-2H3 |
| InChIKey | MIWWSGDADVMLTG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fexinidazole (CHEBI:749938) has role antiinfective agent (CHEBI:35441) |
| fexinidazole (CHEBI:749938) has role antileishmanial agent (CHEBI:70868) |
| fexinidazole (CHEBI:749938) has role trypanocidal drug (CHEBI:36335) |
| fexinidazole (CHEBI:749938) is a C-nitro compound (CHEBI:35716) |
| fexinidazole (CHEBI:749938) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| fexinidazol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fexinidazole | ChEMBL |
| HOE 239 | ChEMBL |
| HOE-239 | ChEMBL |
| Citations |
|---|