EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749938 - fexinidazole
| Formula | C12H13N3O3S |
| Net Charge | 0 |
| Average Mass | 279.321 |
| Monoisotopic Mass | 279.06776 |
| SMILES | CSc1ccc(OCc2ncc([N+](=O)[O-])n2C)cc1 |
| InChI | InChI=1S/C12H13N3O3S/c1-14-11(13-7-12(14)15(16)17)8-18-9-3-5-10(19-2)6-4-9/h3-7H,8H2,1-2H3 |
| InChIKey | MIWWSGDADVMLTG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fexinidazole (CHEBI:749938) has role antiinfective agent (CHEBI:35441) |
| fexinidazole (CHEBI:749938) has role antileishmanial agent (CHEBI:70868) |
| fexinidazole (CHEBI:749938) has role trypanocidal drug (CHEBI:36335) |
| fexinidazole (CHEBI:749938) is a C-nitro compound (CHEBI:35716) |
| fexinidazole (CHEBI:749938) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| fexinidazol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fexinidazole | ChEMBL |
| HOE 239 | ChEMBL |
| HOE-239 | ChEMBL |
| Citations |
|---|