EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O4S |
| Net Charge | 0 |
| Average Mass | 259.287 |
| Monoisotopic Mass | 259.06268 |
| SMILES | Nc1ccn([C@@H]2S[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O4S/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | GAKJJSAXUFZQTL-CCXZUQQUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiarabine (CHEBI:749936) has role antineoplastic agent (CHEBI:35610) |
| thiarabine (CHEBI:749936) is a nucleoside analogue (CHEBI:60783) |
| Synonyms | Source |
|---|---|
| 4'-thioaracytidine | ChEMBL |
| OSI-7836 | ChEMBL |
| Thiarabine | ChEMBL |
| Thio-cytarabine | ChEMBL |
| Citations |
|---|