EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H23N5O3 |
| Net Charge | 0 |
| Average Mass | 441.491 |
| Monoisotopic Mass | 441.18009 |
| SMILES | CCN1c2ncc(CCOc3cc[n+]([O-])c4ccccc34)cc2C(=O)N(C)c2cccnc21 |
| InChI | InChI=1S/C25H23N5O3/c1-3-29-23-19(25(31)28(2)21-9-6-12-26-24(21)29)15-17(16-27-23)11-14-33-22-10-13-30(32)20-8-5-4-7-18(20)22/h4-10,12-13,15-16H,3,11,14H2,1-2H3 |
| InChIKey | BEMBRAMZGVDPMH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bilr 355 (CHEBI:749933) has role anti-HIV agent (CHEBI:64946) |
| bilr 355 (CHEBI:749933) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| Synonym | Source |
|---|---|
| Bilr 355 | ChEMBL |
| Citations |
|---|