EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O4 |
| Net Charge | 0 |
| Average Mass | 294.351 |
| Monoisotopic Mass | 294.15796 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C15H22N2O4/c1-3-9(2)13(15(20)21)17-14(19)12(16)8-10-4-6-11(18)7-5-10/h4-7,9,12-13,18H,3,8,16H2,1-2H3,(H,17,19)(H,20,21)/t9-,12-,13-/m0/s1 |
| InChIKey | QJKMCQRFHJRIPU-XDTLVQLUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-Ile (CHEBI:74993) has role metabolite (CHEBI:25212) |
| Tyr-Ile (CHEBI:74993) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tyrosyl-L-isoleucine |
| Synonyms | Source |
|---|---|
| L-Tyr-L-Ile | ChEBI |
| tyrosylisoleucine | ChEBI |
| YI | ChEBI |
| Tyrosyl-Isoleucine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029108 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3559679 | Reaxys |