EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N2O2.C16H18N2O4S |
| Net Charge | 0 |
| Average Mass | 570.712 |
| Monoisotopic Mass | 570.25121 |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1.[H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H18N2O4S.C13H20N2O2/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);5-8H,3-4,9-10,14H2,1-2H3/t11-,12+,14-;/m1./s1 |
| InChIKey | WHRVRSCEWKLAHX-LQDWTQKMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procaine benzylpenicillin (CHEBI:749925) has role antibacterial agent (CHEBI:33282) |
| procaine benzylpenicillin (CHEBI:749925) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| E707 | ChEMBL |
| Procaine benzylpenicillin | ChEMBL |
| Brand Names | Source |
|---|---|
| Cilicaine syringe | ChEMBL |
| Depocillin | ChEMBL |