EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C20H10O5.Na |
| Net Charge | 0 |
| Average Mass | 376.275 |
| Monoisotopic Mass | 376.03236 |
| SMILES | O=C([O-])c1ccccc1-c1c2ccc(=O)cc-2oc2cc([O-])ccc12.[Na+].[Na+] |
| InChI | InChI=1S/C20H12O5.2Na/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24;;/h1-10,21H,(H,23,24);;/q;2*+1/p-2 |
| InChIKey | NJDNXYGOVLYJHP-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluorescein sodium (CHEBI:749924) has role antineoplastic agent (CHEBI:35610) |
| fluorescein sodium (CHEBI:749924) has role cardiovascular drug (CHEBI:35554) |
| fluorescein sodium (CHEBI:749924) is a neoflavonoid (CHEBI:71971) |
| Synonyms | Source |
|---|---|
| Acid yellow 73 sodium salt | ChEMBL |
| Ci 45350 | ChEMBL |
| C.i. acid yellow 73 | ChEMBL |
| Fluorescein disodium salt | ChEMBL |
| Fluorescein, disodium salt | ChEMBL |
| Fluorescein sodium | ChEMBL |
| Brand Names | Source |
|---|---|
| Fluor-amps | ChEMBL |
| Fluorescite | ChEMBL |
| Fluorets | ChEMBL |
| Funduscein-25 | ChEMBL |
| Retinofluor | ChEMBL |
| Citations |
|---|