EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N3O5 |
| Net Charge | 0 |
| Average Mass | 295.295 |
| Monoisotopic Mass | 295.11682 |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C13H17N3O5/c14-10(5-8-1-3-9(17)4-2-8)13(21)16-6-11(18)15-7-12(19)20/h1-4,10,17H,5-7,14H2,(H,15,18)(H,16,21)(H,19,20)/t10-/m0/s1 |
| InChIKey | HIINQLBHPIQYHN-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-Gly-Gly (CHEBI:74991) has role metabolite (CHEBI:25212) |
| Tyr-Gly-Gly (CHEBI:74991) is a tripeptide (CHEBI:47923) |
| Tyr-Gly-Gly (CHEBI:74991) is tautomer of Tyr-Gly-Gly zwitterion (CHEBI:190708) |
| Incoming Relation(s) |
| Tyr-Gly-Gly zwitterion (CHEBI:190708) is tautomer of Tyr-Gly-Gly (CHEBI:74991) |
| IUPAC Name |
|---|
| L-tyrosylglycylglycine |
| Synonyms | Source |
|---|---|
| L-Tyr-Gly-Gly | ChEBI |
| tyrosylglycylglycine | ChEBI |
| YGG | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3222438 | Reaxys |
| Citations |
|---|