EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O4 |
| Net Charge | 0 |
| Average Mass | 238.243 |
| Monoisotopic Mass | 238.09536 |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C11H14N2O4/c12-9(11(17)13-6-10(15)16)5-7-1-3-8(14)4-2-7/h1-4,9,14H,5-6,12H2,(H,13,17)(H,15,16)/t9-/m0/s1 |
| InChIKey | HPYDSVWYXXKHRD-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-Gly (CHEBI:74990) has role metabolite (CHEBI:25212) |
| Tyr-Gly (CHEBI:74990) is a dipeptide (CHEBI:46761) |
| Tyr-Gly (CHEBI:74990) is tautomer of Tyr-Gly zwitterion (CHEBI:191210) |
| Incoming Relation(s) |
| Tyr-Gly zwitterion (CHEBI:191210) is tautomer of Tyr-Gly (CHEBI:74990) |
| IUPAC Name |
|---|
| L-tyrosylglycine |
| Synonyms | Source |
|---|---|
| L-Tyr-Gly | ChEBI |
| tyrosylglycine | ChEBI |
| Tyrosyl-Glycine | HMDB |
| YG | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB112109 | FooDB |
| HMDB0029105 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2142807 | Reaxys |
| CAS:673-08-5 | ChemIDplus |
| Citations |
|---|