EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C34H41N7O5 |
| Net Charge | 0 |
| Average Mass | 723.853 |
| Monoisotopic Mass | 723.30503 |
| SMILES | CCCCCCOC(=O)NC(=N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C34H41N7O5.CH4O3S/c1-4-6-7-10-21-46-34(44)39-32(35)24-12-15-26(16-13-24)37-23-30-38-27-22-25(14-17-28(27)40(30)3)33(43)41(20-18-31(42)45-5-2)29-11-8-9-19-36-29;1-5(2,3)4/h8-9,11-17,19,22,37H,4-7,10,18,20-21,23H2,1-3H3,(H2,35,39,44);1H3,(H,2,3,4) |
| InChIKey | XETBXHPXHHOLOE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anticoagulant An agent that prevents blood clotting. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dabigatran etexilate mesylate (CHEBI:749899) has role anti-arrhythmia drug (CHEBI:38070) |
| dabigatran etexilate mesylate (CHEBI:749899) has role anticoagulant (CHEBI:50249) |
| dabigatran etexilate mesylate (CHEBI:749899) is a benzimidazoles (CHEBI:22715) |
| Synonyms | Source |
|---|---|
| BIBR 1048 MS | ChEMBL |
| BIBR-1048-MS | ChEMBL |
| Brand Names | Source |
|---|---|
| Dabigatran etexilate accord | ChEMBL |
| Dabigatran etexilate leon farma | ChEMBL |
| Pradaxa (dabigatran etexilate mesylate) | ChEMBL |