EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19F3IN3O5 |
| Net Charge | 0 |
| Average Mass | 565.286 |
| Monoisotopic Mass | 565.03215 |
| SMILES | O=C(NOCCO)c1cc(CN2OCCCC2=O)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C20H19F3IN3O5/c21-14-9-12(24)3-4-15(14)25-19-13(20(30)26-31-7-5-28)8-11(17(22)18(19)23)10-27-16(29)2-1-6-32-27/h3-4,8-9,25,28H,1-2,5-7,10H2,(H,26,30) |
| InChIKey | FIMYFEGKMOCQKT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ro-4987655 (CHEBI:749897) has role antineoplastic agent (CHEBI:35610) |
| ro-4987655 (CHEBI:749897) is a carbonyl compound (CHEBI:36586) |
| ro-4987655 (CHEBI:749897) is a organohalogen compound (CHEBI:17792) |
| Synonyms | Source |
|---|---|
| CH-4987655 | ChEMBL |
| Ro 4987655 | ChEMBL |
| Ro-4987655 | ChEMBL |
| RO4987655 | ChEMBL |
| Citations |
|---|