EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25ClF3N5O3 |
| Net Charge | 0 |
| Average Mass | 547.965 |
| Monoisotopic Mass | 547.15980 |
| SMILES | CC(C)(O)CC(=O)NCCn1ccc2ncnc(Nc3ccc(Oc4cccc(C(F)(F)F)c4)c(Cl)c3)c21 |
| InChI | InChI=1S/C26H25ClF3N5O3/c1-25(2,37)14-22(36)31-9-11-35-10-8-20-23(35)24(33-15-32-20)34-17-6-7-21(19(27)13-17)38-18-5-3-4-16(12-18)26(28,29)30/h3-8,10,12-13,15,37H,9,11,14H2,1-2H3,(H,31,36)(H,32,33,34) |
| InChIKey | ZYQXEVJIFYIBHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tak-285 (CHEBI:749896) has role antineoplastic agent (CHEBI:35610) |
| tak-285 (CHEBI:749896) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Tak 285 | ChEMBL |
| Tak-285 | ChEMBL |
| Tak285 | ChEMBL |
| Citations |
|---|