EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6.C11H14N2S |
| Net Charge | 0 |
| Average Mass | 356.400 |
| Monoisotopic Mass | 356.10421 |
| SMILES | CN1CCCN=C1/C=C/c1cccs1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C11H14N2S.C4H6O6/c1-13-8-3-7-12-11(13)6-5-10-4-2-9-14-10;5-1(3(7)8)2(6)4(9)10/h2,4-6,9H,3,7-8H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/b6-5+; |
| InChIKey | VWRCYAZJKNPEQR-IPZCTEOASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrantel tartrate (CHEBI:749877) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| CP-10,423-18 | ChEMBL |
| Pyrantel bitartrate | ChEMBL |
| Strongid | ChEMBL |