EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749852 - diethylstilbestrol dipropionate
| Formula | C24H28O4 |
| Net Charge | 0 |
| Average Mass | 380.484 |
| Monoisotopic Mass | 380.19876 |
| SMILES | CCC(=O)Oc1ccc(/C(CC)=C(\CC)c2ccc(OC(=O)CC)cc2)cc1 |
| InChI | InChI=1S/C24H28O4/c1-5-21(17-9-13-19(14-10-17)27-23(25)7-3)22(6-2)18-11-15-20(16-12-18)28-24(26)8-4/h9-16H,5-8H2,1-4H3/b22-21+ |
| InChIKey | VZMLEMYJUIIHNF-QURGRASLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethylstilbestrol dipropionate (CHEBI:749852) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| Diethylstilbestrol dipropionate | ChEMBL |
| Diethylstilbestrol propionate | ChEMBL |
| Brand Name | Source |
|---|---|
| Dibestil | ChEMBL |
| Citations |
|---|