EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O2 |
| Net Charge | 0 |
| Average Mass | 350.462 |
| Monoisotopic Mass | 350.19943 |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)OCCN(C)C)cc12 |
| InChI | InChI=1S/C22H26N2O2/c1-16-17(2)24(15-18-8-6-5-7-9-18)21-11-10-19(14-20(16)21)22(25)26-13-12-23(3)4/h5-11,14H,12-13,15H2,1-4H3 |
| InChIKey | YKWQHMLRAPIWDP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indocate (CHEBI:749849) is a indolyl carboxylic acid (CHEBI:46867) |
| INNs | Source |
|---|---|
| indocate | WHO MedNet |
| indocato | WHO MedNet |