EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23NO4S |
| Net Charge | 0 |
| Average Mass | 385.485 |
| Monoisotopic Mass | 385.13478 |
| SMILES | CC(=O)SC[C@@H](Cc1ccccc1)C(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO4S/c1-16(23)27-15-19(12-17-8-4-2-5-9-17)21(25)22-13-20(24)26-14-18-10-6-3-7-11-18/h2-11,19H,12-15H2,1H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | ODUOJXZPIYUATO-LJQANCHMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ecadotril (CHEBI:749845) is a N-acylglycine (CHEBI:16180) |
| INN | Source |
|---|---|
| ecadotrilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY Y 7432 | ChEMBL |
| BAY-Y-7432 | ChEMBL |
| BP 1.02 | ChEMBL |
| BP-1.02 | ChEMBL |
| Racecadotril (s)-form | ChEMBL |
| S-049 | ChEMBL |