EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749837 - moroxydine
| Formula | C6H13N5O |
| Net Charge | 0 |
| Average Mass | 171.204 |
| Monoisotopic Mass | 171.11201 |
| SMILES | N=C(N)NC(=N)N1CCOCC1 |
| InChI | InChI=1S/C6H13N5O/c7-5(8)10-6(9)11-1-3-12-4-2-11/h1-4H2,(H5,7,8,9,10) |
| InChIKey | KJHOZAZQWVKILO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moroxydine (CHEBI:749837) has role antiviral agent (CHEBI:22587) |
| moroxydine (CHEBI:749837) is a biguanides (CHEBI:53662) |
| INN | Source |
|---|---|
| moroxidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Moroxydine | ChEMBL |
| SKF 8898-A | ChEMBL |
| SKF-8898-A | ChEMBL |
| SKF-8898A | ChEMBL |
| Citations |
|---|