EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7N3O2S |
| Net Charge | 0 |
| Average Mass | 173.197 |
| Monoisotopic Mass | 173.02590 |
| SMILES | Cc1nnc(SCC(=O)O)n1 |
| InChI | InChI=1S/C5H7N3O2S/c1-3-6-5(8-7-3)11-2-4(9)10/h2H2,1H3,(H,9,10)(H,6,7,8) |
| InChIKey | OJUNWHNRDPRNBR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiazotic acid (CHEBI:749836) has role cardiovascular drug (CHEBI:35554) |
| tiazotic acid (CHEBI:749836) is a aryl sulfide (CHEBI:35683) |
| INNs | Source |
|---|---|
| acide tiazotique | WHO MedNet |
| acido tiazotico | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-78999 | ChEMBL |
| Tiazotic acid | ChEMBL |