EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C19H17O6S |
| Net Charge | 0 |
| Average Mass | 396.396 |
| Monoisotopic Mass | 396.06435 |
| SMILES | Cc1c(S(=O)(=O)[O-])oc2c1C(=O)C(=O)c1c-2ccc2c1CCCC2(C)C.[Na+] |
| InChI | InChI=1S/C19H18O6S.Na/c1-9-13-15(20)16(21)14-10-5-4-8-19(2,3)12(10)7-6-11(14)17(13)25-18(9)26(22,23)24;/h6-7H,4-5,8H2,1-3H3,(H,22,23,24);/q;+1/p-1 |
| InChIKey | AZEZEAABTDXEHR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium tanshinone iia sulfonate (CHEBI:749826) has role antihypertensive agent (CHEBI:35674) |
| sodium tanshinone iia sulfonate (CHEBI:749826) is a abietane diterpenoid (CHEBI:36762) |
| Synonym | Source |
|---|---|
| Sodium tanshinone iia sulfonate | ChEMBL |
| Citations |
|---|