EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749825 - perospirone
| Formula | C23H30N4O2S |
| Net Charge | 0 |
| Average Mass | 426.586 |
| Monoisotopic Mass | 426.20895 |
| SMILES | [H][C@@]12CCCC[C@]1([H])C(=O)N(CCCCN1CCN(c3nsc4ccccc34)CC1)C2=O |
| InChI | InChI=1S/C23H30N4O2S/c28-22-17-7-1-2-8-18(17)23(29)27(22)12-6-5-11-25-13-15-26(16-14-25)21-19-9-3-4-10-20(19)30-24-21/h3-4,9-10,17-18H,1-2,5-8,11-16H2/t17-,18+ |
| InChIKey | FBVFZWUMDDXLLG-HDICACEKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perospirone (CHEBI:749825) is a N-arylpiperazine (CHEBI:46848) |
| INNs | Source |
|---|---|
| perospirona | WHO MedNet |
| perospirone | WHO MedNet |
| Citations |
|---|