EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749820 - chlorindanol
| Formula | C9H9ClO |
| Net Charge | 0 |
| Average Mass | 168.623 |
| Monoisotopic Mass | 168.03419 |
| SMILES | Oc1ccc(Cl)c2c1CCC2 |
| InChI | InChI=1S/C9H9ClO/c10-8-4-5-9(11)7-3-1-2-6(7)8/h4-5,11H,1-3H2 |
| InChIKey | ATAJVFBUUIBIEO-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorindanol (CHEBI:749820) is a indanes (CHEBI:46940) |
| INN | Source |
|---|---|
| clorindanol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chlorindanol | ChEMBL |
| NSC-158565 | ChEMBL |