EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749812 - chlorothymol
| Formula | C10H13ClO |
| Net Charge | 0 |
| Average Mass | 184.666 |
| Monoisotopic Mass | 184.06549 |
| SMILES | Cc1cc(O)c(C(C)C)cc1Cl |
| InChI | InChI=1S/C10H13ClO/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6,12H,1-3H3 |
| InChIKey | KFZXVMNBUMVKLN-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorothymol (CHEBI:749812) is a monoterpenoid (CHEBI:25409) |
| Synonyms | Source |
|---|---|
| 4-chlorothymol | ChEMBL |
| 6-chlorothymol | ChEMBL |
| Chlorothymol | ChEMBL |
| Monochlorothymol | ChEMBL |
| NSC-406261 | ChEMBL |
| NSC-4964 | ChEMBL |
| Citations |
|---|