EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C4H6O6.C8H11NO3 |
| Net Charge | 0 |
| Average Mass | 337.281 |
| Monoisotopic Mass | 337.10090 |
| SMILES | NC[C@H](O)c1ccc(O)c(O)c1.O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C8H11NO3.C4H6O6.H2O/c9-4-8(12)5-1-2-6(10)7(11)3-5;5-1(3(7)8)2(6)4(9)10;/h1-3,8,10-12H,4,9H2;1-2,5-6H,(H,7,8)(H,9,10);1H2/t8-;;/m0../s1 |
| InChIKey | LNBCGLZYLJMGKP-JZGIKJSDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norepinephrine bitartrate (CHEBI:749807) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| Arterenol, tartrate, monohydrate | ChEMBL |
| Binodrenal | ChEMBL |
| Levarterenol bitartrate | ChEMBL |
| Noradrenaline (as tartrate) | ChEMBL |
| Noradrenaline bitartrate | ChEMBL |
| Noradrenaline tartrate | ChEMBL |
| Brand Name | Source |
|---|---|
| Norepinephrine bitartrate in 5% dextrose | ChEMBL |