EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2.C16H18N2O5S.C16H18N2O5S |
| Net Charge | 0 |
| Average Mass | 941.142 |
| Monoisotopic Mass | 940.34993 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)COc1ccccc1.[H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)COc1ccccc1.c1ccc(CNCCNCc2ccccc2)cc1 |
| InChI | InChI=1S/2C16H18N2O5S.C16H20N2/c2*1-16(2)12(15(21)22)18-13(20)11(14(18)24-16)17-10(19)8-23-9-6-4-3-5-7-9;1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h2*3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);1-10,17-18H,11-14H2/t2*11-,12+,14-;/m11./s1 |
| InChIKey | BBTOYUUSUQNIIY-ANPZCEIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penicillin v benzathine (CHEBI:749797) has role antibacterial agent (CHEBI:33282) |
| penicillin v benzathine (CHEBI:749797) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| Penicillin benzathine phenoxymethyl | ChEMBL |
| Penicillin v compd with dibenzylethylenediamine | ChEMBL |
| Phenoxymethylpenicillin benzathine | ChEMBL |