EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C21H21ClN4OS.HCl |
| Net Charge | 0 |
| Average Mass | 467.422 |
| Monoisotopic Mass | 466.09970 |
| SMILES | Cl.O.O=C1Cc2cc(CCN3CCN(c4nsc5ccccc45)CC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C21H21ClN4OS.ClH.H2O/c22-17-13-18-15(12-20(27)23-18)11-14(17)5-6-25-7-9-26(10-8-25)21-16-3-1-2-4-19(16)28-24-21;;/h1-4,11,13H,5-10,12H2,(H,23,27);1H;1H2 |
| InChIKey | ZCBZSCBNOOIHFP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ziprasidone hydrochloride (CHEBI:749789) has role anti-arrhythmia drug (CHEBI:38070) |
| ziprasidone hydrochloride (CHEBI:749789) has role antipsychotic agent (CHEBI:35476) |
| ziprasidone hydrochloride (CHEBI:749789) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| CP-88,059-1 | ChEMBL |
| CP-88059-1 | ChEMBL |
| CP-880591 | ChEMBL |
| Ziprasidone hydrochloride hydrate | ChEMBL |