EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749783 - canrenoate potassium
| Formula | K.C22H29O4 |
| Net Charge | 0 |
| Average Mass | 396.568 |
| Monoisotopic Mass | 396.17029 |
| SMILES | [H][C@@]12C=CC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@](O)(CCC(=O)[O-])CC[C@@]21[H].[K+] |
| InChI | InChI=1S/C22H30O4.K/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21,26)12-8-19(24)25;/h3-4,13,16-18,26H,5-12H2,1-2H3,(H,24,25);/q;+1/p-1/t16-,17+,18+,20+,21+,22-;/m1./s1 |
| InChIKey | JTZQCHFUGHIPDF-RYVBEKKQSA-M |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| canrenoate potassium (CHEBI:749783) has role androgen (CHEBI:50113) |
| canrenoate potassium (CHEBI:749783) has role cardiovascular drug (CHEBI:35554) |
| canrenoate potassium (CHEBI:749783) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| canrenoate de potassium | WHO MedNet |
| canrenoato de potasio | WHO MedNet |
| Synonyms | Source |
|---|---|
| Canrenone free acid potassium salt | ChEMBL |
| NSC-757789 | ChEMBL |
| Potassium canrenoate | ChEMBL |
| SC-14266 | ChEMBL |
| Brand Names | Source |
|---|---|
| Soldactone | ChEMBL |
| Spiroctan-m | ChEMBL |
| Citations |
|---|