EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N2O2P |
| Net Charge | 0 |
| Average Mass | 274.260 |
| Monoisotopic Mass | 274.08711 |
| SMILES | NNC(=O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15N2O2P/c15-16-14(17)11-19(18,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11,15H2,(H,16,17) |
| InChIKey | PMHFLBQRALFMRT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosenazide (CHEBI:749775) is a phosphine (CHEBI:35883) |
| INNs | Source |
|---|---|
| fosenazida | WHO MedNet |
| fosenazide | WHO MedNet |