EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749769 - cycliramine maleate
| Formula | C4H4O4.C18H19ClN2 |
| Net Charge | 0 |
| Average Mass | 414.889 |
| Monoisotopic Mass | 414.13463 |
| SMILES | CN1CCC(=C(c2ccc(Cl)cc2)c2ccccn2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H19ClN2.C4H4O4/c1-21-12-9-15(10-13-21)18(17-4-2-3-11-20-17)14-5-7-16(19)8-6-14;5-3(6)1-2-4(7)8/h2-8,11H,9-10,12-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | KJSKCUMUVXPETM-BTJKTKAUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cycliramine maleate (CHEBI:749769) is a organochlorine compound (CHEBI:36683) |
| Synonyms | Source |
|---|---|
| Cycliramine maleate | ChEMBL |
| NSC-70933 | ChEMBL |
| SCH 2544 | ChEMBL |
| SCH-2544 | ChEMBL |
| Brand Name | Source |
|---|---|
| Prolergic | ChEMBL |