EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 259.214 |
| Monoisotopic Mass | 259.06920 |
| SMILES | O=C(O)C(O)C(O)C(=O)O.OCc1cccnc1 |
| InChI | InChI=1S/C6H7NO.C4H6O6/c8-5-6-2-1-3-7-4-6;5-1(3(7)8)2(6)4(9)10/h1-4,8H,5H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | NPORIZAYKBQYLF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicotinyl tartrate (CHEBI:749763) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| Nicotinyl alcohol d-tartrate | ChEMBL |
| Nicotinyl tartrate | ChEMBL |
| NSC-147492 | ChEMBL |