EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N6O2 |
| Net Charge | 0 |
| Average Mass | 406.490 |
| Monoisotopic Mass | 406.21172 |
| SMILES | CC[C@H](Nc1cc(C)nc2c(-c3ccc(OC)cc3C)c(C)nn12)c1nc(C)no1 |
| InChI | InChI=1S/C22H26N6O2/c1-7-18(22-24-15(5)27-30-22)25-19-11-13(3)23-21-20(14(4)26-28(19)21)17-9-8-16(29-6)10-12(17)2/h8-11,18,25H,7H2,1-6H3/t18-/m0/s1 |
| InChIKey | VKHVAUKFLBBZFJ-SFHVURJKSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| verucerfont (CHEBI:749754) has role antidepressant (CHEBI:35469) |
| verucerfont (CHEBI:749754) has role antispasmodic drug (CHEBI:53784) |
| verucerfont (CHEBI:749754) is a pyrazoles (CHEBI:26410) |
| verucerfont (CHEBI:749754) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| verucerfont | WHO MedNet |
| Synonyms | Source |
|---|---|
| GSK-561,679 | ChEMBL |
| GSK-561679 | ChEMBL |
| GSK561679 | ChEMBL |
| GSK-561679A | ChEMBL |
| GSK561679A | ChEMBL |
| NBI-77860 | ChEMBL |
| Citations |
|---|