EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N6O2 |
| Net Charge | 0 |
| Average Mass | 406.490 |
| Monoisotopic Mass | 406.21172 |
| SMILES | CC[C@H](Nc1cc(C)nc2c(-c3ccc(OC)cc3C)c(C)nn12)c1nc(C)no1 |
| InChI | InChI=1S/C22H26N6O2/c1-7-18(22-24-15(5)27-30-22)25-19-11-13(3)23-21-20(14(4)26-28(19)21)17-9-8-16(29-6)10-12(17)2/h8-11,18,25H,7H2,1-6H3/t18-/m0/s1 |
| InChIKey | VKHVAUKFLBBZFJ-SFHVURJKSA-N |
| Roles Classification |
|---|
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| verucerfont (CHEBI:749754) has role antidepressant (CHEBI:35469) |
| verucerfont (CHEBI:749754) has role antispasmodic drug (CHEBI:53784) |
| verucerfont (CHEBI:749754) is a pyrazoles (CHEBI:26410) |
| verucerfont (CHEBI:749754) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| verucerfont | WHO MedNet |
| Synonyms | Source |
|---|---|
| GSK-561,679 | ChEMBL |
| GSK-561679 | ChEMBL |
| GSK561679 | ChEMBL |
| GSK-561679A | ChEMBL |
| GSK561679A | ChEMBL |
| NBI-77860 | ChEMBL |
| Citations |
|---|