EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27FN4O2 |
| Net Charge | 0 |
| Average Mass | 410.493 |
| Monoisotopic Mass | 410.21180 |
| SMILES | CCN(CC)CCN1CCc2nc(/C=C3\C(=O)Nc4ccc(F)cc43)c(C)c2C1=O |
| InChI | InChI=1S/C23H27FN4O2/c1-4-27(5-2)10-11-28-9-8-19-21(23(28)30)14(3)20(25-19)13-17-16-12-15(24)6-7-18(16)26-22(17)29/h6-7,12-13,25H,4-5,8-11H2,1-3H3,(H,26,29)/b17-13- |
| InChIKey | GKEYKDOLBLYGRB-LGMDPLHJSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| famitinib (CHEBI:749753) has role antineoplastic agent (CHEBI:35610) |
| famitinib (CHEBI:749753) is a pyrrolopyridine (CHEBI:46771) |
| INN | Source |
|---|---|
| famitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Shr-1020 | ChEMBL |
| SHR1020 | ChEMBL |
| Citations |
|---|