EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24FN5O4 |
| Net Charge | 0 |
| Average Mass | 441.463 |
| Monoisotopic Mass | 441.18123 |
| SMILES | COc1cc(OC)cc(N2CCN(C(=O)Nc3nc4cc(F)ccc4nc3OC)CC2)c1 |
| InChI | InChI=1S/C22H24FN5O4/c1-30-16-11-15(12-17(13-16)31-2)27-6-8-28(9-7-27)22(29)26-20-21(32-3)25-18-5-4-14(23)10-19(18)24-20/h4-5,10-13H,6-9H2,1-3H3,(H,24,26,29) |
| InChIKey | KAKPGJJRYRYSTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| supinoxin (CHEBI:749752) has role antineoplastic agent (CHEBI:35610) |
| supinoxin (CHEBI:749752) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| P-p68 inhibitor rx-5902 | ChEMBL |
| RX-5902 | ChEMBL |
| Supinoxin | ChEMBL |
| Citations |
|---|