EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29FN4O4 |
| Net Charge | 0 |
| Average Mass | 468.529 |
| Monoisotopic Mass | 468.21728 |
| SMILES | Cc1c(/C=C2\C(=O)Nc3ccc(F)cc32)nc2c1C(=O)N(C[C@H](O)CN1CCOCC1)CCC2 |
| InChI | InChI=1S/C25H29FN4O4/c1-15-22(12-19-18-11-16(26)4-5-20(18)28-24(19)32)27-21-3-2-6-30(25(33)23(15)21)14-17(31)13-29-7-9-34-10-8-29/h4-5,11-12,17,27,31H,2-3,6-10,13-14H2,1H3,(H,28,32)/b19-12-/t17-/m1/s1 |
| InChIKey | MCTXSDCWFQAGFS-UEXNTNOUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| henatinib (CHEBI:749751) has role antineoplastic agent (CHEBI:35610) |
| henatinib (CHEBI:749751) is a organic heterobicyclic compound (CHEBI:27171) |
| henatinib (CHEBI:749751) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| Synonym | Source |
|---|---|
| Henatinib | ChEMBL |
| Citations |
|---|