EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N3O2 |
| Net Charge | 0 |
| Average Mass | 231.255 |
| Monoisotopic Mass | 231.10078 |
| SMILES | O=C(c1ccc2nonc2c1)N1CCCCC1 |
| InChI | InChI=1S/C12H13N3O2/c16-12(15-6-2-1-3-7-15)9-4-5-10-11(8-9)14-17-13-10/h4-5,8H,1-3,6-7H2 |
| InChIKey | XFVRBYKKGGDPAJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farampator (CHEBI:749748) has role antidepressant (CHEBI:35469) |
| farampator (CHEBI:749748) has role antipsychotic agent (CHEBI:35476) |
| farampator (CHEBI:749748) is a N-acylpiperidine (CHEBI:48591) |
| INN | Source |
|---|---|
| farampator | WHO MedNet |
| Synonyms | Source |
|---|---|
| CX 691 | ChEMBL |
| CX-691 | ChEMBL |
| CX691 | ChEMBL |
| ORG 24448 | ChEMBL |
| ORG-24448 | ChEMBL |
| SCH-900460 | ChEMBL |
| Citations |
|---|