EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749737 - bradanicline
| Formula | C22H23N3O2 |
| Net Charge | 0 |
| Average Mass | 361.445 |
| Monoisotopic Mass | 361.17903 |
| SMILES | [H][C@@]1(NC(=O)c2cc3ccccc3o2)C2CCN(CC2)[C@@]1([H])Cc1cccnc1 |
| InChI | InChI=1S/C22H23N3O2/c26-22(20-13-17-5-1-2-6-19(17)27-20)24-21-16-7-10-25(11-8-16)18(21)12-15-4-3-9-23-14-15/h1-6,9,13-14,16,18,21H,7-8,10-12H2,(H,24,26)/t18-,21+/m0/s1 |
| InChIKey | OXKRFEWMSWPKKV-GHTZIAJQSA-N |
| Roles Classification |
|---|
| Applications: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bradanicline (CHEBI:749737) has role antipsychotic agent (CHEBI:35476) |
| bradanicline (CHEBI:749737) has role antitussive (CHEBI:51177) |
| bradanicline (CHEBI:749737) is a benzofurans (CHEBI:35259) |
| INNs | Source |
|---|---|
| bradaniclina | WHO MedNet |
| bradanicline | WHO MedNet |
| Synonyms | Source |
|---|---|
| ATA-101 | ChEMBL |
| TC 5619 | ChEMBL |
| TC-5619 | ChEMBL |
| Citations |
|---|