EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749735 - tecovirimat
| Formula | C19H15F3N2O3 |
| Net Charge | 0 |
| Average Mass | 376.334 |
| Monoisotopic Mass | 376.10348 |
| SMILES | [H][C@]12C=C[C@]([H])([C@]3([H])C[C@]13[H])[C@@]1([H])C(=O)N(NC(=O)c3ccc(C(F)(F)F)cc3)C(=O)[C@@]21[H] |
| InChI | InChI=1S/C19H15F3N2O3/c20-19(21,22)9-3-1-8(2-4-9)16(25)23-24-17(26)14-10-5-6-11(13-7-12(10)13)15(14)18(24)27/h1-6,10-15H,7H2,(H,23,25)/t10-,11+,12+,13-,14-,15+ |
| InChIKey | CSKDFZIMJXRJGH-VWLPUNTISA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tecovirimat (CHEBI:749735) has role antiviral agent (CHEBI:22587) |
| tecovirimat (CHEBI:749735) is a isoindoles (CHEBI:24897) |
| Synonyms | Source |
|---|---|
| SIGA-246 | ChEMBL |
| ST 246 | ChEMBL |
| ST-246 | ChEMBL |
| Tecovirimat | ChEMBL |
| Brand Name | Source |
|---|---|
| Tpoxx | ChEMBL |
| Citations |
|---|