EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NO8S |
| Net Charge | 0 |
| Average Mass | 397.405 |
| Monoisotopic Mass | 397.08314 |
| SMILES | [H][C@]1(C2=C(C(=O)OCc3oc(=O)oc3C)N3C(=O)[C@]([H])([C@@H](C)O)[C@@]3([H])S2)CCCO1 |
| InChI | InChI=1S/C17H19NO8S/c1-7(19)11-14(20)18-12(13(27-15(11)18)9-4-3-5-23-9)16(21)24-6-10-8(2)25-17(22)26-10/h7,9,11,15,19H,3-6H2,1-2H3/t7-,9-,11+,15-/m1/s1 |
| InChIKey | JQBKWZPHJOEQAO-DVPVEWDBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| faropenem medoxomil (CHEBI:749734) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| A-0026 | ChEMBL |
| A0026 | ChEMBL |
| BAY-56-6854 | ChEMBL |
| Fropenem daloxate | ChEMBL |
| SUN-A0026 | ChEMBL |
| Citations |
|---|