EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18FN3O4 |
| Net Charge | 0 |
| Average Mass | 371.368 |
| Monoisotopic Mass | 371.12813 |
| SMILES | Cn1c(=O)c(C(=O)NCCO)c(O)c2ncc(Cc3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C19H18FN3O4/c1-23-14-9-12(8-11-2-4-13(20)5-3-11)10-22-16(14)17(25)15(19(23)27)18(26)21-6-7-24/h2-5,9-10,24-25H,6-8H2,1H3,(H,21,26) |
| InChIKey | QWLNINWUBHHOLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-364735 (CHEBI:749730) has role anti-HIV agent (CHEBI:64946) |
| gsk-364735 (CHEBI:749730) is a naphthyridine derivative (CHEBI:73539) |
| Synonyms | Source |
|---|---|
| Gsk-364735 | ChEMBL |
| GSK364735 | ChEMBL |
| S-364735 | ChEMBL |
| S/GSK 364735 | ChEMBL |
| S/GSK-364735 | ChEMBL |
| Citations |
|---|