EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C17H19N3 |
| Net Charge | 0 |
| Average Mass | 301.821 |
| Monoisotopic Mass | 301.13458 |
| SMILES | Cl.c1ccc(CN(CC2=NCCN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N3.ClH/c1-3-7-15(8-4-1)13-20(14-17-18-11-12-19-17)16-9-5-2-6-10-16;/h1-10H,11-14H2,(H,18,19);1H |
| InChIKey | SWKDMSRRIBZZAY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antazoline hydrochloride (CHEBI:749727) has role anti-inflammatory agent (CHEBI:67079) |
| antazoline hydrochloride (CHEBI:749727) is a aromatic amine (CHEBI:33860) |
| Brand Names | Source |
|---|---|
| Antaz hcl | ChEMBL |
| R.b.c. | ChEMBL |
| Citations |
|---|