EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O8.HCl |
| Net Charge | 0 |
| Average Mass | 480.901 |
| Monoisotopic Mass | 480.12994 |
| SMILES | Cl.[H][C@@]12C(=C(O)[C@]3(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]3([H])[C@H]1O)C(=O)c1c(O)cccc1[C@@H]2C |
| InChI | InChI=1S/C22H24N2O8.ClH/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29;/h4-7,10,14-15,17,25,27-29,32H,1-3H3,(H2,23,31);1H/t7-,10+,14+,15-,17-,22-;/m0./s1 |
| InChIKey | RUYHIJHUVHIMIR-CVHRZJFOSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxycycline hydrochloride (CHEBI:749719) has role antiinfective agent (CHEBI:35441) |
| doxycycline hydrochloride (CHEBI:749719) has role antiviral agent (CHEBI:22587) |
| doxycycline hydrochloride (CHEBI:749719) is a tetracyclines (CHEBI:26895) |
| Synonym | Source |
|---|---|
| NSC-756751 | ChEMBL |
| Citations |
|---|